C28H33ClN8 — CID 155058914
8-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]-9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine (PubChem CID 155058914) has the molecular formula C28H33ClN8 and a molecular weight of 517.08 g/mol. Its IUPAC name is 8-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]-9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine.
| Compound Name | 8-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]-9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine |
|---|---|
| PubChem CID | 155058914 |
| Molecular Formula | C28H33ClN8 |
| Molecular Weight | 517.08 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 8-N-[(2E,4Z)-3-chlorohepta-2,4-dien-6-ynyl]-9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine |
| SMILES | C#C/C=C\C(Cl)=C/CNc1nc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C28H33ClN8/c1-3-4-7-21(29)14-15-30-28-33-25-20-31-27(34-26(25)37(28)24-8-5-6-9-24)32-22-10-12-23(13-11-22)36-18-16-35(2)17-19-36/h1,4,7,10-14,20,24H,5-6,8-9,15-19H2,2H3,(H,30,33)(H,31,32,34)/b7-4-,21-14+ |
| InChIKey | MSKUDNPMAKMKHJ-CGNROUMQSA-N |
| XLogP | 5.16 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|