C27H33N9 — CID 54760771
9-cyclopentyl-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-pyridin-3-ylpurine-2,8-diamine (PubChem CID 54760771) has the molecular formula C27H33N9 and a molecular weight of 483.62 g/mol. Its IUPAC name is 9-cyclopentyl-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-pyridin-3-ylpurine-2,8-diamine.
| Compound Name | 9-cyclopentyl-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-pyridin-3-ylpurine-2,8-diamine |
|---|---|
| PubChem CID | 54760771 |
| Molecular Formula | C27H33N9 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | 9-cyclopentyl-6-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-N-pyridin-3-ylpurine-2,8-diamine |
| SMILES | Cc1nc(Nc2ccc(N3CCN(C)CC3)cc2)nc2c1nc(Nc1cccnc1)n2C1CCCC1 |
| InChI | InChI=1S/C27H33N9/c1-19-24-25(36(23-7-3-4-8-23)27(32-24)31-21-6-5-13-28-18-21)33-26(29-19)30-20-9-11-22(12-10-20)35-16-14-34(2)15-17-35/h5-6,9-13,18,23H,3-4,7-8,14-17H2,1-2H3,(H,31,32)(H,29,30,33) |
| InChIKey | RMERYNJGRCERRO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|