C27H30BrFN8 — CID 54761134
8-N-(4-bromo-2-fluorophenyl)-9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine (PubChem CID 54761134) has the molecular formula C27H30BrFN8 and a molecular weight of 565.50 g/mol. Its IUPAC name is 8-N-(4-bromo-2-fluorophenyl)-9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine.
| Compound Name | 8-N-(4-bromo-2-fluorophenyl)-9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine |
|---|---|
| PubChem CID | 54761134 |
| Molecular Formula | C27H30BrFN8 |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | 8-N-(4-bromo-2-fluorophenyl)-9-cyclopentyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]purine-2,8-diamine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4nc(Nc5ccc(Br)cc5F)n(C5CCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C27H30BrFN8/c1-35-12-14-36(15-13-35)20-9-7-19(8-10-20)31-26-30-17-24-25(34-26)37(21-4-2-3-5-21)27(33-24)32-23-11-6-18(28)16-22(23)29/h6-11,16-17,21H,2-5,12-15H2,1H3,(H,32,33)(H,30,31,34) |
| InChIKey | GVZBXXCSWXSGHS-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|