C23H23FN6 — CID 67574383
9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(3-methylphenyl)purine-2,8-diamine (PubChem CID 67574383) has the molecular formula C23H23FN6 and a molecular weight of 402.48 g/mol. Its IUPAC name is 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(3-methylphenyl)purine-2,8-diamine.
| Compound Name | 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(3-methylphenyl)purine-2,8-diamine |
|---|---|
| PubChem CID | 67574383 |
| Molecular Formula | C23H23FN6 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 9-cyclopentyl-8-N-(2-fluorophenyl)-2-N-(3-methylphenyl)purine-2,8-diamine |
| SMILES | Cc1cccc(Nc2ncc3nc(Nc4ccccc4F)n(C4CCCC4)c3n2)c1 |
| InChI | InChI=1S/C23H23FN6/c1-15-7-6-8-16(13-15)26-22-25-14-20-21(29-22)30(17-9-2-3-10-17)23(28-20)27-19-12-5-4-11-18(19)24/h4-8,11-14,17H,2-3,9-10H2,1H3,(H,27,28)(H,25,26,29) |
| InChIKey | OUGUONZNWLYSBO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |