C24H25F3N6O — CID 168982679
ethane;9-(oxan-4-yl)-2-N-phenyl-8-N-(2,4,6-trifluorophenyl)purine-2,8-diamine (PubChem CID 168982679) has the molecular formula C24H25F3N6O and a molecular weight of 470.50 g/mol. Its IUPAC name is ethane;9-(oxan-4-yl)-2-N-phenyl-8-N-(2,4,6-trifluorophenyl)purine-2,8-diamine.
| Compound Name | ethane;9-(oxan-4-yl)-2-N-phenyl-8-N-(2,4,6-trifluorophenyl)purine-2,8-diamine |
|---|---|
| PubChem CID | 168982679 |
| Molecular Formula | C24H25F3N6O |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | ethane;9-(oxan-4-yl)-2-N-phenyl-8-N-(2,4,6-trifluorophenyl)purine-2,8-diamine |
| SMILES | CC.Fc1cc(F)c(Nc2nc3cnc(Nc4ccccc4)nc3n2C2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C22H19F3N6O.C2H6/c23-13-10-16(24)19(17(25)11-13)29-22-28-18-12-26-21(27-14-4-2-1-3-5-14)30-20(18)31(22)15-6-8-32-9-7-15;1-2/h1-5,10-12,15H,6-9H2,(H,28,29)(H,26,27,30);1-2H3 |
| InChIKey | GQEHYFNOVNPJFW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |