C24H30FN5O — CID 157086612
4-[2-(cyclohexylmethyl)-8-(2-fluoroanilino)purin-9-yl]cyclohexan-1-ol (PubChem CID 157086612) has the molecular formula C24H30FN5O and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-[2-(cyclohexylmethyl)-8-(2-fluoroanilino)purin-9-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(cyclohexylmethyl)-8-(2-fluoroanilino)purin-9-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 157086612 |
| Molecular Formula | C24H30FN5O |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 4-[2-(cyclohexylmethyl)-8-(2-fluoroanilino)purin-9-yl]cyclohexan-1-ol |
| SMILES | OC1CCC(n2c(Nc3ccccc3F)nc3cnc(CC4CCCCC4)nc32)CC1 |
| InChI | InChI=1S/C24H30FN5O/c25-19-8-4-5-9-20(19)27-24-28-21-15-26-22(14-16-6-2-1-3-7-16)29-23(21)30(24)17-10-12-18(31)13-11-17/h4-5,8-9,15-18,31H,1-3,6-7,10-14H2,(H,27,28) |
| InChIKey | AEDWBRPWLRHSEY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |