C22H28FN5O — CID 160676464
(2R)-2-[2-(cyclohexylmethyl)-8-(2-fluoroanilino)purin-9-yl]butan-1-ol (PubChem CID 160676464) has the molecular formula C22H28FN5O and a molecular weight of 397.50 g/mol. Its IUPAC name is (2R)-2-[2-(cyclohexylmethyl)-8-(2-fluoroanilino)purin-9-yl]butan-1-ol.
| Compound Name | (2R)-2-[2-(cyclohexylmethyl)-8-(2-fluoroanilino)purin-9-yl]butan-1-ol |
|---|---|
| PubChem CID | 160676464 |
| Molecular Formula | C22H28FN5O |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | (2R)-2-[2-(cyclohexylmethyl)-8-(2-fluoroanilino)purin-9-yl]butan-1-ol |
| SMILES | CC[C@H](CO)n1c(Nc2ccccc2F)nc2cnc(CC3CCCCC3)nc21 |
| InChI | InChI=1S/C22H28FN5O/c1-2-16(14-29)28-21-19(26-22(28)25-18-11-7-6-10-17(18)23)13-24-20(27-21)12-15-8-4-3-5-9-15/h6-7,10-11,13,15-16,29H,2-5,8-9,12,14H2,1H3,(H,25,26)/t16-/m1/s1 |
| InChIKey | RNOZNAPDKBRQQW-MRXNPFEDSA-N |
| XLogP | 4.78 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |