C20H27FN6O — CID 158977450
8-N-(2-fluorophenyl)-2-N-(oxan-4-yl)-9-propan-2-ylpurine-2,8-diamine;methane (PubChem CID 158977450) has the molecular formula C20H27FN6O and a molecular weight of 386.48 g/mol. Its IUPAC name is 8-N-(2-fluorophenyl)-2-N-(oxan-4-yl)-9-propan-2-ylpurine-2,8-diamine;methane.
| Compound Name | 8-N-(2-fluorophenyl)-2-N-(oxan-4-yl)-9-propan-2-ylpurine-2,8-diamine;methane |
|---|---|
| PubChem CID | 158977450 |
| Molecular Formula | C20H27FN6O |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 8-N-(2-fluorophenyl)-2-N-(oxan-4-yl)-9-propan-2-ylpurine-2,8-diamine;methane |
| SMILES | C.CC(C)n1c(Nc2ccccc2F)nc2cnc(NC3CCOCC3)nc21 |
| InChI | InChI=1S/C19H23FN6O.CH4/c1-12(2)26-17-16(24-19(26)23-15-6-4-3-5-14(15)20)11-21-18(25-17)22-13-7-9-27-10-8-13;/h3-6,11-13H,7-10H2,1-2H3,(H,23,24)(H,21,22,25);1H4 |
| InChIKey | JOOMIRBPQSKGHJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |