About 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide
4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121254300) has the molecular formula C23H27F2N7O2
and a molecular weight of 471.51 g/mol. Its IUPAC name is 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide |
| PubChem CID | 121254300 |
| Molecular Formula | C23H27F2N7O2 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(n2c(Nc3cccc(F)c3F)nc3cnc(NC4CCOCC4)nc32)CC1 |
| InChI | InChI=1S/C23H27F2N7O2/c24-16-2-1-3-17(19(16)25)29-23-30-18-12-27-22(28-14-8-10-34-11-9-14)31-21(18)32(23)15-6-4-13(5-7-15)20(26)33/h1-3,12-15H,4-11H2,(H2,26,33)(H,29,30)(H,27,28,31) |
| InChIKey | IHZDFJLIGDHTFQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide?
The IUPAC name of 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide (CID 121254300) is 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide.
What is the SMILES notation for 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide?
The canonical SMILES for 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide is NC(=O)C1CCC(n2c(Nc3cccc(F)c3F)nc3cnc(NC4CCOCC4)nc32)CC1.
What is the InChIKey of 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide?
The InChIKey is IHZDFJLIGDHTFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27F2N7O2/c24-16-2-1-3-17(19(16)25)29-23-30-18-12-27-22(28-14-8-10-34-11-9-14)31-21(18)32(23)15-6-4-13(5-7-15)20(26)33/h1-3,12-15H,4-11H2,(H2,26,33)(H,29,30)(H,27,28,31).
What are the key properties of 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide?
4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide has a molecular weight of 471.51 g/mol, XLogP of 3.66, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[8-(2,3-difluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide is sourced from PubChem (CID 121254300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).