C23H27FN6O3 — CID 121254222
4-[8-(4-fluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxylic acid (PubChem CID 121254222) has the molecular formula C23H27FN6O3 and a molecular weight of 454.51 g/mol. Its IUPAC name is 4-[8-(4-fluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[8-(4-fluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121254222 |
| Molecular Formula | C23H27FN6O3 |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 4-[8-(4-fluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(n2c(Nc3ccc(F)cc3)nc3cnc(NC4CCOCC4)nc32)CC1 |
| InChI | InChI=1S/C23H27FN6O3/c24-15-3-5-16(6-4-15)27-23-28-19-13-25-22(26-17-9-11-33-12-10-17)29-20(19)30(23)18-7-1-14(2-8-18)21(31)32/h3-6,13-14,17-18H,1-2,7-12H2,(H,27,28)(H,31,32)(H,25,26,29) |
| InChIKey | KIQNGXNETQTZEI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |