C24H30FN7O2 — CID 121254081
4-[8-(4-fluoro-2-methylanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121254081) has the molecular formula C24H30FN7O2 and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-[8-(4-fluoro-2-methylanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[8-(4-fluoro-2-methylanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121254081 |
| Molecular Formula | C24H30FN7O2 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 4-[8-(4-fluoro-2-methylanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | Cc1cc(F)ccc1Nc1nc2cnc(NC3CCOCC3)nc2n1C1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C24H30FN7O2/c1-14-12-16(25)4-7-19(14)29-24-30-20-13-27-23(28-17-8-10-34-11-9-17)31-22(20)32(24)18-5-2-15(3-6-18)21(26)33/h4,7,12-13,15,17-18H,2-3,5-6,8-11H2,1H3,(H2,26,33)(H,29,30)(H,27,28,31) |
| InChIKey | OAAMPJWHSLVTIM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |