C23H26Cl3N7O2 — CID 121254227
4-[2-(oxan-4-ylamino)-8-(2,4,5-trichloroanilino)purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121254227) has the molecular formula C23H26Cl3N7O2 and a molecular weight of 538.87 g/mol. Its IUPAC name is 4-[2-(oxan-4-ylamino)-8-(2,4,5-trichloroanilino)purin-9-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[2-(oxan-4-ylamino)-8-(2,4,5-trichloroanilino)purin-9-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121254227 |
| Molecular Formula | C23H26Cl3N7O2 |
| Molecular Weight | 538.87 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | 4-[2-(oxan-4-ylamino)-8-(2,4,5-trichloroanilino)purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(n2c(Nc3cc(Cl)c(Cl)cc3Cl)nc3cnc(NC4CCOCC4)nc32)CC1 |
| InChI | InChI=1S/C23H26Cl3N7O2/c24-15-9-17(26)18(10-16(15)25)30-23-31-19-11-28-22(29-13-5-7-35-8-6-13)32-21(19)33(23)14-3-1-12(2-4-14)20(27)34/h9-14H,1-8H2,(H2,27,34)(H,30,31)(H,28,29,32) |
| InChIKey | NSJSWODKTQVKEQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.87 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|