C23H28FN7O2 — CID 121254567
4-[8-(4-fluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121254567) has the molecular formula C23H28FN7O2 and a molecular weight of 453.52 g/mol. Its IUPAC name is 4-[8-(4-fluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[8-(4-fluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121254567 |
| Molecular Formula | C23H28FN7O2 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[8-(4-fluoroanilino)-2-(oxan-4-ylamino)purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(n2c(Nc3ccc(F)cc3)nc3cnc(NC4CCOCC4)nc32)CC1 |
| InChI | InChI=1S/C23H28FN7O2/c24-15-3-5-16(6-4-15)28-23-29-19-13-26-22(27-17-9-11-33-12-10-17)30-21(19)31(23)18-7-1-14(2-8-18)20(25)32/h3-6,13-14,17-18H,1-2,7-12H2,(H2,25,32)(H,28,29)(H,26,27,30) |
| InChIKey | PXEBQVYPOKBESB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |