C24H29F2N7O2 — CID 121260987
4-[8-(2,4-difluoroanilino)-2-[[(3R)-3-methyloxan-4-yl]amino]purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121260987) has the molecular formula C24H29F2N7O2 and a molecular weight of 485.54 g/mol. Its IUPAC name is 4-[8-(2,4-difluoroanilino)-2-[[(3R)-3-methyloxan-4-yl]amino]purin-9-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[8-(2,4-difluoroanilino)-2-[[(3R)-3-methyloxan-4-yl]amino]purin-9-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121260987 |
| Molecular Formula | C24H29F2N7O2 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 4-[8-(2,4-difluoroanilino)-2-[[(3R)-3-methyloxan-4-yl]amino]purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | C[C@H]1COCCC1Nc1ncc2nc(Nc3ccc(F)cc3F)n(C3CCC(C(N)=O)CC3)c2n1 |
| InChI | InChI=1S/C24H29F2N7O2/c1-13-12-35-9-8-18(13)29-23-28-11-20-22(32-23)33(16-5-2-14(3-6-16)21(27)34)24(31-20)30-19-7-4-15(25)10-17(19)26/h4,7,10-11,13-14,16,18H,2-3,5-6,8-9,12H2,1H3,(H2,27,34)(H,30,31)(H,28,29,32)/t13-,14?,16?,18?/m0/s1 |
| InChIKey | OSRWVVQRSPRZRV-NTMXOVRWSA-N |
| XLogP | 3.90 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |