C21H24F2N6O — CID 70320390
2-N-cyclohexyl-8-N-(2,4-difluorophenyl)-9-[(3S)-oxolan-3-yl]purine-2,8-diamine (PubChem CID 70320390) has the molecular formula C21H24F2N6O and a molecular weight of 414.46 g/mol. Its IUPAC name is 2-N-cyclohexyl-8-N-(2,4-difluorophenyl)-9-[(3S)-oxolan-3-yl]purine-2,8-diamine.
| Compound Name | 2-N-cyclohexyl-8-N-(2,4-difluorophenyl)-9-[(3S)-oxolan-3-yl]purine-2,8-diamine |
|---|---|
| PubChem CID | 70320390 |
| Molecular Formula | C21H24F2N6O |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2-N-cyclohexyl-8-N-(2,4-difluorophenyl)-9-[(3S)-oxolan-3-yl]purine-2,8-diamine |
| SMILES | Fc1ccc(Nc2nc3cnc(NC4CCCCC4)nc3n2[C@H]2CCOC2)c(F)c1 |
| InChI | InChI=1S/C21H24F2N6O/c22-13-6-7-17(16(23)10-13)26-21-27-18-11-24-20(25-14-4-2-1-3-5-14)28-19(18)29(21)15-8-9-30-12-15/h6-7,10-11,14-15H,1-5,8-9,12H2,(H,26,27)(H,24,25,28)/t15-/m0/s1 |
| InChIKey | UKIVFNSBBXNFQI-HNNXBMFYSA-N |
| XLogP | 4.55 |
| TPSA | 76.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |