C22H24ClF2N7O3 — CID 121253394
4-[8-(4-chloro-2,3-difluoroanilino)-2-[[(3S,4R)-4-hydroxyoxolan-3-yl]amino]purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121253394) has the molecular formula C22H24ClF2N7O3 and a molecular weight of 507.93 g/mol. Its IUPAC name is 4-[8-(4-chloro-2,3-difluoroanilino)-2-[[(3S,4R)-4-hydroxyoxolan-3-yl]amino]purin-9-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[8-(4-chloro-2,3-difluoroanilino)-2-[[(3S,4R)-4-hydroxyoxolan-3-yl]amino]purin-9-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121253394 |
| Molecular Formula | C22H24ClF2N7O3 |
| Molecular Weight | 507.93 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 4-[8-(4-chloro-2,3-difluoroanilino)-2-[[(3S,4R)-4-hydroxyoxolan-3-yl]amino]purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(n2c(Nc3ccc(Cl)c(F)c3F)nc3cnc(N[C@H]4COC[C@@H]4O)nc32)CC1 |
| InChI | InChI=1S/C22H24ClF2N7O3/c23-12-5-6-13(18(25)17(12)24)29-22-30-14-7-27-21(28-15-8-35-9-16(15)33)31-20(14)32(22)11-3-1-10(2-4-11)19(26)34/h5-7,10-11,15-16,33H,1-4,8-9H2,(H2,26,34)(H,29,30)(H,27,28,31)/t10?,11?,15-,16-/m0/s1 |
| InChIKey | VNARMMLCGKIBHA-VVUBSENTSA-N |
| XLogP | 2.89 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.93 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|