C24H28ClF2N7O2 — CID 121254357
4-[8-(4-chloro-2,3-difluoroanilino)-2-[[(1S,3R)-3-hydroxycyclohexyl]amino]purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121254357) has the molecular formula C24H28ClF2N7O2 and a molecular weight of 519.98 g/mol. Its IUPAC name is 4-[8-(4-chloro-2,3-difluoroanilino)-2-[[(1S,3R)-3-hydroxycyclohexyl]amino]purin-9-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[8-(4-chloro-2,3-difluoroanilino)-2-[[(1S,3R)-3-hydroxycyclohexyl]amino]purin-9-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121254357 |
| Molecular Formula | C24H28ClF2N7O2 |
| Molecular Weight | 519.98 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 4-[8-(4-chloro-2,3-difluoroanilino)-2-[[(1S,3R)-3-hydroxycyclohexyl]amino]purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(n2c(Nc3ccc(Cl)c(F)c3F)nc3cnc(N[C@H]4CCC[C@@H](O)C4)nc32)CC1 |
| InChI | InChI=1S/C24H28ClF2N7O2/c25-16-8-9-17(20(27)19(16)26)31-24-32-18-11-29-23(30-13-2-1-3-15(35)10-13)33-22(18)34(24)14-6-4-12(5-7-14)21(28)36/h8-9,11-15,35H,1-7,10H2,(H2,28,36)(H,31,32)(H,29,30,33)/t12?,13-,14?,15+/m0/s1 |
| InChIKey | UIIGQJRMHOFNIR-OOJKYFRXSA-N |
| XLogP | 4.43 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|