C24H27F3N8O3 — CID 130475786
3-[[9-(4-carbamoylcyclohexyl)-8-(2,3,4-trifluoroanilino)purin-2-yl]amino]piperidine-1-carboxylic acid (PubChem CID 130475786) has the molecular formula C24H27F3N8O3 and a molecular weight of 532.53 g/mol. Its IUPAC name is 3-[[9-(4-carbamoylcyclohexyl)-8-(2,3,4-trifluoroanilino)purin-2-yl]amino]piperidine-1-carboxylic acid.
| Compound Name | 3-[[9-(4-carbamoylcyclohexyl)-8-(2,3,4-trifluoroanilino)purin-2-yl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 130475786 |
| Molecular Formula | C24H27F3N8O3 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 3-[[9-(4-carbamoylcyclohexyl)-8-(2,3,4-trifluoroanilino)purin-2-yl]amino]piperidine-1-carboxylic acid |
| SMILES | NC(=O)C1CCC(n2c(Nc3ccc(F)c(F)c3F)nc3cnc(NC4CCCN(C(=O)O)C4)nc32)CC1 |
| InChI | InChI=1S/C24H27F3N8O3/c25-15-7-8-16(19(27)18(15)26)31-23-32-17-10-29-22(30-13-2-1-9-34(11-13)24(37)38)33-21(17)35(23)14-5-3-12(4-6-14)20(28)36/h7-8,10,12-14H,1-6,9,11H2,(H2,28,36)(H,31,32)(H,37,38)(H,29,30,33) |
| InChIKey | JXSODIZHZUZRIK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 151.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|