C22H22ClF4N7O — CID 121254319
4-[8-(3-chloro-2,6-difluoroanilino)-2-[(3,3-difluorocyclobutyl)amino]purin-9-yl]cyclohexane-1-carboxamide (PubChem CID 121254319) has the molecular formula C22H22ClF4N7O and a molecular weight of 511.91 g/mol. Its IUPAC name is 4-[8-(3-chloro-2,6-difluoroanilino)-2-[(3,3-difluorocyclobutyl)amino]purin-9-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-[8-(3-chloro-2,6-difluoroanilino)-2-[(3,3-difluorocyclobutyl)amino]purin-9-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121254319 |
| Molecular Formula | C22H22ClF4N7O |
| Molecular Weight | 511.91 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | 4-[8-(3-chloro-2,6-difluoroanilino)-2-[(3,3-difluorocyclobutyl)amino]purin-9-yl]cyclohexane-1-carboxamide |
| SMILES | NC(=O)C1CCC(n2c(Nc3c(F)ccc(Cl)c3F)nc3cnc(NC4CC(F)(F)C4)nc32)CC1 |
| InChI | InChI=1S/C22H22ClF4N7O/c23-13-5-6-14(24)17(16(13)25)32-21-31-15-9-29-20(30-11-7-22(26,27)8-11)33-19(15)34(21)12-3-1-10(2-4-12)18(28)35/h5-6,9-12H,1-4,7-8H2,(H2,28,35)(H,31,32)(H,29,30,33) |
| InChIKey | SDPNCHAQOLGSOZ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|