C21H26FN7O — CID 130311368
4-[[8-(2-fluoroanilino)-9-(3-methyliminopropyl)purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 130311368) has the molecular formula C21H26FN7O and a molecular weight of 411.49 g/mol. Its IUPAC name is 4-[[8-(2-fluoroanilino)-9-(3-methyliminopropyl)purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[8-(2-fluoroanilino)-9-(3-methyliminopropyl)purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 130311368 |
| Molecular Formula | C21H26FN7O |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-[[8-(2-fluoroanilino)-9-(3-methyliminopropyl)purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | C/N=C/CCn1c(Nc2ccccc2F)nc2cnc(NC3CCC(O)CC3)nc21 |
| InChI | InChI=1S/C21H26FN7O/c1-23-11-4-12-29-19-18(27-21(29)26-17-6-3-2-5-16(17)22)13-24-20(28-19)25-14-7-9-15(30)10-8-14/h2-3,5-6,11,13-15,30H,4,7-10,12H2,1H3,(H,26,27)(H,24,25,28)/b23-11+ |
| InChIKey | GQISQUGYQWOQGC-FOKLQQMPSA-N |
| XLogP | 3.52 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|