C24H37FN6O — CID 143262358
acetylene;(Z)-but-2-ene;4-[[8-[[(Z)-2-fluoroprop-1-enyl]amino]-9-(2-methylpropyl)purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 143262358) has the molecular formula C24H37FN6O and a molecular weight of 444.60 g/mol. Its IUPAC name is acetylene;(Z)-but-2-ene;4-[[8-[[(Z)-2-fluoroprop-1-enyl]amino]-9-(2-methylpropyl)purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | acetylene;(Z)-but-2-ene;4-[[8-[[(Z)-2-fluoroprop-1-enyl]amino]-9-(2-methylpropyl)purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143262358 |
| Molecular Formula | C24H37FN6O |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | acetylene;(Z)-but-2-ene;4-[[8-[[(Z)-2-fluoroprop-1-enyl]amino]-9-(2-methylpropyl)purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | C#C.C/C(F)=C/Nc1nc2cnc(NC3CCC(O)CC3)nc2n1CC(C)C.C/C=C\C |
| InChI | InChI=1S/C18H27FN6O.C4H8.C2H2/c1-11(2)10-25-16-15(23-18(25)21-8-12(3)19)9-20-17(24-16)22-13-4-6-14(26)7-5-13;1-3-4-2;1-2/h8-9,11,13-14,26H,4-7,10H2,1-3H3,(H,21,23)(H,20,22,24);3-4H,1-2H3;1-2H/b12-8-;4-3-; |
| InChIKey | KMMAZQNEABFDJB-OUMSJRQTSA-N |
| XLogP | 5.27 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|