C22H28FN7 — CID 57392289
2-N-(4-aminocyclohexyl)-9-cyclopentyl-8-N-(2-fluorophenyl)purine-2,8-diamine (PubChem CID 57392289) has the molecular formula C22H28FN7 and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-9-cyclopentyl-8-N-(2-fluorophenyl)purine-2,8-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-8-N-(2-fluorophenyl)purine-2,8-diamine |
|---|---|
| PubChem CID | 57392289 |
| Molecular Formula | C22H28FN7 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-9-cyclopentyl-8-N-(2-fluorophenyl)purine-2,8-diamine |
| SMILES | NC1CCC(Nc2ncc3nc(Nc4ccccc4F)n(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C22H28FN7/c23-17-7-3-4-8-18(17)27-22-28-19-13-25-21(26-15-11-9-14(24)10-12-15)29-20(19)30(22)16-5-1-2-6-16/h3-4,7-8,13-16H,1-2,5-6,9-12,24H2,(H,27,28)(H,25,26,29) |
| InChIKey | ORAWIJDEGBHDCO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |