About [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate
[4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate (PubChem CID 123490212) has the molecular formula C25H32FN7O2
and a molecular weight of 481.58 g/mol. Its IUPAC name is [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate.
Molecular Properties
| Compound Name | [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate |
| PubChem CID | 123490212 |
| Molecular Formula | C25H32FN7O2 |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate |
| SMILES | Cc1cccc(F)c1Nc1nc2cnc(NC3CCC(OC(=O)CN)CC3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C25H32FN7O2/c1-15-5-4-8-19(26)22(15)31-25-30-20-14-28-24(32-23(20)33(25)17-6-2-3-7-17)29-16-9-11-18(12-10-16)35-21(34)13-27/h4-5,8,14,16-18H,2-3,6-7,9-13,27H2,1H3,(H,30,31)(H,28,29,32) |
| InChIKey | ARENHIYZKRXPJI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate?
The IUPAC name of [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate (CID 123490212) is [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate.
What is the SMILES notation for [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate?
The canonical SMILES for [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate is Cc1cccc(F)c1Nc1nc2cnc(NC3CCC(OC(=O)CN)CC3)nc2n1C1CCCC1.
What is the InChIKey of [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate?
The InChIKey is ARENHIYZKRXPJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32FN7O2/c1-15-5-4-8-19(26)22(15)31-25-30-20-14-28-24(32-23(20)33(25)17-6-2-3-7-17)29-16-9-11-18(12-10-16)35-21(34)13-27/h4-5,8,14,16-18H,2-3,6-7,9-13,27H2,1H3,(H,30,31)(H,28,29,32).
What are the key properties of [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate?
[4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate has a molecular weight of 481.58 g/mol, XLogP of 4.36, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[9-cyclopentyl-8-(2-fluoro-6-methylanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate is sourced from PubChem (CID 123490212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).