C24H27F2N7O2 — CID 143572782
[4-[[9-cyclopent-2-en-1-yl-8-(2,6-difluoroanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate (PubChem CID 143572782) has the molecular formula C24H27F2N7O2 and a molecular weight of 483.52 g/mol. Its IUPAC name is [4-[[9-cyclopent-2-en-1-yl-8-(2,6-difluoroanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate.
| Compound Name | [4-[[9-cyclopent-2-en-1-yl-8-(2,6-difluoroanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate |
|---|---|
| PubChem CID | 143572782 |
| Molecular Formula | C24H27F2N7O2 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | [4-[[9-cyclopent-2-en-1-yl-8-(2,6-difluoroanilino)purin-2-yl]amino]cyclohexyl] 2-aminoacetate |
| SMILES | NCC(=O)OC1CCC(Nc2ncc3nc(Nc4c(F)cccc4F)n(C4C=CCC4)c3n2)CC1 |
| InChI | InChI=1S/C24H27F2N7O2/c25-17-6-3-7-18(26)21(17)31-24-30-19-13-28-23(32-22(19)33(24)15-4-1-2-5-15)29-14-8-10-16(11-9-14)35-20(34)12-27/h1,3-4,6-7,13-16H,2,5,8-12,27H2,(H,30,31)(H,28,29,32) |
| InChIKey | FOQPPLNZXYSUQZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|