C23H29FN6O — CID 148812916
2-[(4-aminocyclohexyl)methyl]-N-(2-fluorophenyl)-9-(oxan-4-yl)purin-8-amine (PubChem CID 148812916) has the molecular formula C23H29FN6O and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[(4-aminocyclohexyl)methyl]-N-(2-fluorophenyl)-9-(oxan-4-yl)purin-8-amine.
| Compound Name | 2-[(4-aminocyclohexyl)methyl]-N-(2-fluorophenyl)-9-(oxan-4-yl)purin-8-amine |
|---|---|
| PubChem CID | 148812916 |
| Molecular Formula | C23H29FN6O |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 2-[(4-aminocyclohexyl)methyl]-N-(2-fluorophenyl)-9-(oxan-4-yl)purin-8-amine |
| SMILES | NC1CCC(Cc2ncc3nc(Nc4ccccc4F)n(C4CCOCC4)c3n2)CC1 |
| InChI | InChI=1S/C23H29FN6O/c24-18-3-1-2-4-19(18)27-23-28-20-14-26-21(13-15-5-7-16(25)8-6-15)29-22(20)30(23)17-9-11-31-12-10-17/h1-4,14-17H,5-13,25H2,(H,27,28) |
| InChIKey | OQGRUJYDTPWOSS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |