C26H32ClN9 — CID 172553753
2-N-[4-[4-(3-chloropropyl)piperazin-1-yl]phenyl]-9-propan-2-yl-8-N-pyridin-3-ylpurine-2,8-diamine (PubChem CID 172553753) has the molecular formula C26H32ClN9 and a molecular weight of 506.06 g/mol. Its IUPAC name is 2-N-[4-[4-(3-chloropropyl)piperazin-1-yl]phenyl]-9-propan-2-yl-8-N-pyridin-3-ylpurine-2,8-diamine.
| Compound Name | 2-N-[4-[4-(3-chloropropyl)piperazin-1-yl]phenyl]-9-propan-2-yl-8-N-pyridin-3-ylpurine-2,8-diamine |
|---|---|
| PubChem CID | 172553753 |
| Molecular Formula | C26H32ClN9 |
| Molecular Weight | 506.06 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 2-N-[4-[4-(3-chloropropyl)piperazin-1-yl]phenyl]-9-propan-2-yl-8-N-pyridin-3-ylpurine-2,8-diamine |
| SMILES | CC(C)n1c(Nc2cccnc2)nc2cnc(Nc3ccc(N4CCN(CCCCl)CC4)cc3)nc21 |
| InChI | InChI=1S/C26H32ClN9/c1-19(2)36-24-23(32-26(36)31-21-5-3-11-28-17-21)18-29-25(33-24)30-20-6-8-22(9-7-20)35-15-13-34(14-16-35)12-4-10-27/h3,5-9,11,17-19H,4,10,12-16H2,1-2H3,(H,31,32)(H,29,30,33) |
| InChIKey | SHDOVKHLPLJZKM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.06 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|