C27H35N9 — CID 155058892
8-N-[4-(dimethylamino)phenyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-propan-2-ylpurine-2,8-diamine (PubChem CID 155058892) has the molecular formula C27H35N9 and a molecular weight of 485.64 g/mol. Its IUPAC name is 8-N-[4-(dimethylamino)phenyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-propan-2-ylpurine-2,8-diamine.
| Compound Name | 8-N-[4-(dimethylamino)phenyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-propan-2-ylpurine-2,8-diamine |
|---|---|
| PubChem CID | 155058892 |
| Molecular Formula | C27H35N9 |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 8-N-[4-(dimethylamino)phenyl]-2-N-[4-(4-methylpiperazin-1-yl)phenyl]-9-propan-2-ylpurine-2,8-diamine |
| SMILES | CC(C)n1c(Nc2ccc(N(C)C)cc2)nc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C27H35N9/c1-19(2)36-25-24(31-27(36)30-21-6-10-22(11-7-21)33(3)4)18-28-26(32-25)29-20-8-12-23(13-9-20)35-16-14-34(5)15-17-35/h6-13,18-19H,14-17H2,1-5H3,(H,30,31)(H,28,29,32) |
| InChIKey | ITAHVDZOUAMYHZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|