C26H30N9O+ — CID 54759462
4-[(8-anilino-9-propan-2-ylpurin-2-yl)amino]-N-(4-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-yl)benzamide (PubChem CID 54759462) has the molecular formula C26H30N9O+ and a molecular weight of 484.59 g/mol. Its IUPAC name is 4-[(8-anilino-9-propan-2-ylpurin-2-yl)amino]-N-(4-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-yl)benzamide.
| Compound Name | 4-[(8-anilino-9-propan-2-ylpurin-2-yl)amino]-N-(4-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-yl)benzamide |
|---|---|
| PubChem CID | 54759462 |
| Molecular Formula | C26H30N9O+ |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 4-[(8-anilino-9-propan-2-ylpurin-2-yl)amino]-N-(4-methyl-3,5-dihydro-2H-pyrazin-1-ium-1-yl)benzamide |
| SMILES | CC(C)n1c(Nc2ccccc2)nc2cnc(Nc3ccc(C(=O)N[N+]4=CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C26H29N9O/c1-18(2)35-23-22(30-26(35)29-20-7-5-4-6-8-20)17-27-25(31-23)28-21-11-9-19(10-12-21)24(36)32-34-15-13-33(3)14-16-34/h4-12,15,17-18H,13-14,16H2,1-3H3,(H2-,27,28,29,30,31,32,36)/p+1 |
| InChIKey | RPFOKTXBVUCVAD-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|