C33H34N6O — CID 18375264
8-(1,1-diphenylpropan-2-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18375264) has the molecular formula C33H34N6O and a molecular weight of 530.68 g/mol. Its IUPAC name is 8-(1,1-diphenylpropan-2-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(1,1-diphenylpropan-2-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18375264 |
| Molecular Formula | C33H34N6O |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 8-(1,1-diphenylpropan-2-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC(C(c1ccccc1)c1ccccc1)n1c(=O)ccc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc21 |
| InChI | InChI=1S/C33H34N6O/c1-24(31(25-9-5-3-6-10-25)26-11-7-4-8-12-26)39-30(40)18-13-27-23-34-33(36-32(27)39)35-28-14-16-29(17-15-28)38-21-19-37(2)20-22-38/h3-18,23-24,31H,19-22H2,1-2H3,(H,34,35,36) |
| InChIKey | MQFIMDKNGBYMGK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|