C33H34N6O — CID 18375026
2-[4-(4-methylpiperazin-1-yl)anilino]-8-[[2-(2-phenylethyl)phenyl]methyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18375026) has the molecular formula C33H34N6O and a molecular weight of 530.68 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)anilino]-8-[[2-(2-phenylethyl)phenyl]methyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-8-[[2-(2-phenylethyl)phenyl]methyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18375026 |
| Molecular Formula | C33H34N6O |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-8-[[2-(2-phenylethyl)phenyl]methyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(=O)n(Cc5ccccc5CCc5ccccc5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C33H34N6O/c1-37-19-21-38(22-20-37)30-16-14-29(15-17-30)35-33-34-23-27-13-18-31(40)39(32(27)36-33)24-28-10-6-5-9-26(28)12-11-25-7-3-2-4-8-25/h2-10,13-18,23H,11-12,19-22,24H2,1H3,(H,34,35,36) |
| InChIKey | LKUFPBKZNLQRAC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|