C35H38N6O3 — CID 18375017
8-(1,5-diphenoxypentan-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18375017) has the molecular formula C35H38N6O3 and a molecular weight of 590.73 g/mol. Its IUPAC name is 8-(1,5-diphenoxypentan-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(1,5-diphenoxypentan-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18375017 |
| Molecular Formula | C35H38N6O3 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 8-(1,5-diphenoxypentan-3-yl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(=O)n(C(CCOc5ccccc5)CCOc5ccccc5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C35H38N6O3/c1-39-20-22-40(23-21-39)29-15-13-28(14-16-29)37-35-36-26-27-12-17-33(42)41(34(27)38-35)30(18-24-43-31-8-4-2-5-9-31)19-25-44-32-10-6-3-7-11-32/h2-17,26,30H,18-25H2,1H3,(H,36,37,38) |
| InChIKey | XUESZXFDIZAHFV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|