C26H28N6OS — CID 18375128
2-[4-(4-methylpiperazin-1-yl)anilino]-8-[(4-methylsulfanylphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 18375128) has the molecular formula C26H28N6OS and a molecular weight of 472.62 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)anilino]-8-[(4-methylsulfanylphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-8-[(4-methylsulfanylphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 18375128 |
| Molecular Formula | C26H28N6OS |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-8-[(4-methylsulfanylphenyl)methyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CSc1ccc(Cn2c(=O)ccc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc32)cc1 |
| InChI | InChI=1S/C26H28N6OS/c1-30-13-15-31(16-14-30)22-8-6-21(7-9-22)28-26-27-17-20-5-12-24(33)32(25(20)29-26)18-19-3-10-23(34-2)11-4-19/h3-12,17H,13-16,18H2,1-2H3,(H,27,28,29) |
| InChIKey | DTENHCCQQDNHKJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|