C25H24BrFN6O — CID 66760734
8-[(2-bromo-6-fluorophenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 66760734) has the molecular formula C25H24BrFN6O and a molecular weight of 523.41 g/mol. Its IUPAC name is 8-[(2-bromo-6-fluorophenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(2-bromo-6-fluorophenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 66760734 |
| Molecular Formula | C25H24BrFN6O |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 8-[(2-bromo-6-fluorophenyl)methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(=O)n(Cc5c(F)cccc5Br)c4n3)cc2)CC1 |
| InChI | InChI=1S/C25H24BrFN6O/c1-31-11-13-32(14-12-31)19-8-6-18(7-9-19)29-25-28-15-17-5-10-23(34)33(24(17)30-25)16-20-21(26)3-2-4-22(20)27/h2-10,15H,11-14,16H2,1H3,(H,28,29,30) |
| InChIKey | MCAPEFUWBWWNNR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|