C25H24F2N6OS — CID 66760744
8-[(2-fluoro-6-methylsulfanylphenyl)methyl]-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 66760744) has the molecular formula C25H24F2N6OS and a molecular weight of 494.57 g/mol. Its IUPAC name is 8-[(2-fluoro-6-methylsulfanylphenyl)methyl]-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(2-fluoro-6-methylsulfanylphenyl)methyl]-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 66760744 |
| Molecular Formula | C25H24F2N6OS |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 8-[(2-fluoro-6-methylsulfanylphenyl)methyl]-2-(3-fluoro-4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CSc1cccc(F)c1Cn1c(=O)ccc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc21 |
| InChI | InChI=1S/C25H24F2N6OS/c1-35-22-4-2-3-19(26)18(22)15-33-23(34)8-5-16-14-29-25(31-24(16)33)30-17-6-7-21(20(27)13-17)32-11-9-28-10-12-32/h2-8,13-14,28H,9-12,15H2,1H3,(H,29,30,31) |
| InChIKey | ZWISHKSHLJEJSR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|