C25H26ClFN6O — CID 66760579
8-ethyl-2-(3-fluoro-4-piperazin-1-ylanilino)-6-phenylpyrido[2,3-d]pyrimidin-7-one;hydrochloride (PubChem CID 66760579) has the molecular formula C25H26ClFN6O and a molecular weight of 480.98 g/mol. Its IUPAC name is 8-ethyl-2-(3-fluoro-4-piperazin-1-ylanilino)-6-phenylpyrido[2,3-d]pyrimidin-7-one;hydrochloride.
| Compound Name | 8-ethyl-2-(3-fluoro-4-piperazin-1-ylanilino)-6-phenylpyrido[2,3-d]pyrimidin-7-one;hydrochloride |
|---|---|
| PubChem CID | 66760579 |
| Molecular Formula | C25H26ClFN6O |
| Molecular Weight | 480.98 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 8-ethyl-2-(3-fluoro-4-piperazin-1-ylanilino)-6-phenylpyrido[2,3-d]pyrimidin-7-one;hydrochloride |
| SMILES | CCn1c(=O)c(-c2ccccc2)cc2cnc(Nc3ccc(N4CCNCC4)c(F)c3)nc21.Cl |
| InChI | InChI=1S/C25H25FN6O.ClH/c1-2-32-23-18(14-20(24(32)33)17-6-4-3-5-7-17)16-28-25(30-23)29-19-8-9-22(21(26)15-19)31-12-10-27-11-13-31;/h3-9,14-16,27H,2,10-13H2,1H3,(H,28,29,30);1H |
| InChIKey | BDDIDYADCNFIDL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.98 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|