C23H23FN6O2S — CID 71487066
N-(3-fluoro-4-piperazin-1-ylphenyl)-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine (PubChem CID 71487066) has the molecular formula C23H23FN6O2S and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(3-fluoro-4-piperazin-1-ylphenyl)-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine.
| Compound Name | N-(3-fluoro-4-piperazin-1-ylphenyl)-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine |
|---|---|
| PubChem CID | 71487066 |
| Molecular Formula | C23H23FN6O2S |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-(3-fluoro-4-piperazin-1-ylphenyl)-5,5-dioxo-6-prop-2-enylpyrimido[5,4-c][2,1]benzothiazin-2-amine |
| SMILES | C=CCN1c2ccccc2-c2nc(Nc3ccc(N4CCNCC4)c(F)c3)ncc2S1(=O)=O |
| InChI | InChI=1S/C23H23FN6O2S/c1-2-11-30-19-6-4-3-5-17(19)22-21(33(30,31)32)15-26-23(28-22)27-16-7-8-20(18(24)14-16)29-12-9-25-10-13-29/h2-8,14-15,25H,1,9-13H2,(H,26,27,28) |
| InChIKey | IIOPWLAZPNHOJU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|