C25H29N7O2S — CID 71487329
N-[3-methyl-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-8,8-dioxo-9-prop-2-enyl-8λ6-thia-3,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine (PubChem CID 71487329) has the molecular formula C25H29N7O2S and a molecular weight of 491.62 g/mol. Its IUPAC name is N-[3-methyl-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-8,8-dioxo-9-prop-2-enyl-8λ6-thia-3,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine.
| Compound Name | N-[3-methyl-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-8,8-dioxo-9-prop-2-enyl-8λ6-thia-3,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 71487329 |
| Molecular Formula | C25H29N7O2S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[3-methyl-4-(4-methyl-1,4-diazepan-1-yl)phenyl]-8,8-dioxo-9-prop-2-enyl-8λ6-thia-3,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-1(10),2,4,6,11,13-hexaen-4-amine |
| SMILES | C=CCN1c2ncccc2-c2nc(Nc3ccc(N4CCCN(C)CC4)c(C)c3)ncc2S1(=O)=O |
| InChI | InChI=1S/C25H29N7O2S/c1-4-11-32-24-20(7-5-10-26-24)23-22(35(32,33)34)17-27-25(29-23)28-19-8-9-21(18(2)16-19)31-13-6-12-30(3)14-15-31/h4-5,7-10,16-17H,1,6,11-15H2,2-3H3,(H,27,28,29) |
| InChIKey | POFSEEUKBHMTMN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|