C26H32N8O — CID 163799016
6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1-(4-methyl-2-pyridinyl)-2-prop-2-enyl-3H-pyrazolo[3,4-d]pyrimidin-3-ol (PubChem CID 163799016) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1-(4-methyl-2-pyridinyl)-2-prop-2-enyl-3H-pyrazolo[3,4-d]pyrimidin-3-ol.
| Compound Name | 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1-(4-methyl-2-pyridinyl)-2-prop-2-enyl-3H-pyrazolo[3,4-d]pyrimidin-3-ol |
|---|---|
| PubChem CID | 163799016 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1-(4-methyl-2-pyridinyl)-2-prop-2-enyl-3H-pyrazolo[3,4-d]pyrimidin-3-ol |
| SMILES | C=CCN1C(O)c2cnc(Nc3ccc(N4CCN(C)CC4)c(C)c3)nc2N1c1cc(C)ccn1 |
| InChI | InChI=1S/C26H32N8O/c1-5-10-33-25(35)21-17-28-26(30-24(21)34(33)23-15-18(2)8-9-27-23)29-20-6-7-22(19(3)16-20)32-13-11-31(4)12-14-32/h5-9,15-17,25,35H,1,10-14H2,2-4H3,(H,28,29,30) |
| InChIKey | NDIZNGUQGYFPRQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|