C24H28N7O2P — CID 138553840
1-(6-dimethylphosphoryl-2-pyridinyl)-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-3-ol (PubChem CID 138553840) has the molecular formula C24H28N7O2P and a molecular weight of 477.51 g/mol. Its IUPAC name is 1-(6-dimethylphosphoryl-2-pyridinyl)-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-3-ol.
| Compound Name | 1-(6-dimethylphosphoryl-2-pyridinyl)-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-3-ol |
|---|---|
| PubChem CID | 138553840 |
| Molecular Formula | C24H28N7O2P |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 1-(6-dimethylphosphoryl-2-pyridinyl)-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-3-ol |
| SMILES | C=CCN1C(O)c2cnc(Nc3ccc4c(c3)CCNC4)nc2N1c1cccc(P(C)(C)=O)n1 |
| InChI | InChI=1S/C24H28N7O2P/c1-4-12-30-23(32)19-15-26-24(27-18-9-8-17-14-25-11-10-16(17)13-18)29-22(19)31(30)20-6-5-7-21(28-20)34(2,3)33/h4-9,13,15,23,25,32H,1,10-12,14H2,2-3H3,(H,26,27,29) |
| InChIKey | PNZJHVBNJLXHHZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|