C26H30N8O3 — CID 138553684
methyl N-[[6-[3-hydroxy-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-1-yl]-2-pyridinyl]methyl]-N-methylcarbamate (PubChem CID 138553684) has the molecular formula C26H30N8O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is methyl N-[[6-[3-hydroxy-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-1-yl]-2-pyridinyl]methyl]-N-methylcarbamate.
| Compound Name | methyl N-[[6-[3-hydroxy-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-1-yl]-2-pyridinyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 138553684 |
| Molecular Formula | C26H30N8O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | methyl N-[[6-[3-hydroxy-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-1-yl]-2-pyridinyl]methyl]-N-methylcarbamate |
| SMILES | C=CCN1C(O)c2cnc(Nc3ccc4c(c3)CNCC4)nc2N1c1cccc(CN(C)C(=O)OC)n1 |
| InChI | InChI=1S/C26H30N8O3/c1-4-12-33-24(35)21-15-28-25(30-19-9-8-17-10-11-27-14-18(17)13-19)31-23(21)34(33)22-7-5-6-20(29-22)16-32(2)26(36)37-3/h4-9,13,15,24,27,35H,1,10-12,14,16H2,2-3H3,(H,28,30,31) |
| InChIKey | YBGXSFZUKPRYBO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|