C26H29N7O3 — CID 138554069
1-[2-(oxolan-3-yloxy)-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-3-ol (PubChem CID 138554069) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1-[2-(oxolan-3-yloxy)-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-3-ol.
| Compound Name | 1-[2-(oxolan-3-yloxy)-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-3-ol |
|---|---|
| PubChem CID | 138554069 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-[2-(oxolan-3-yloxy)-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)-3H-pyrazolo[3,4-d]pyrimidin-3-ol |
| SMILES | C=CCN1C(O)c2cnc(Nc3ccc4c(c3)CCNC4)nc2N1c1ccnc(OC2CCOC2)c1 |
| InChI | InChI=1S/C26H29N7O3/c1-2-10-32-25(34)22-15-29-26(30-19-4-3-18-14-27-8-5-17(18)12-19)31-24(22)33(32)20-6-9-28-23(13-20)36-21-7-11-35-16-21/h2-4,6,9,12-13,15,21,25,27,34H,1,5,7-8,10-11,14,16H2,(H,29,30,31) |
| InChIKey | MYXJYSYSMQFBCH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|