C16H20N6 — CID 156831460
4-N-cyclopropyl-2-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)pyrimidine-2,4,5-triamine (PubChem CID 156831460) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 4-N-cyclopropyl-2-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)pyrimidine-2,4,5-triamine.
| Compound Name | 4-N-cyclopropyl-2-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)pyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 156831460 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-N-cyclopropyl-2-N-(1,2,3,4-tetrahydroisoquinolin-6-yl)pyrimidine-2,4,5-triamine |
| SMILES | Nc1cnc(Nc2ccc3c(c2)CCNC3)nc1NC1CC1 |
| InChI | InChI=1S/C16H20N6/c17-14-9-19-16(22-15(14)20-12-3-4-12)21-13-2-1-11-8-18-6-5-10(11)7-13/h1-2,7,9,12,18H,3-6,8,17H2,(H2,19,20,21,22) |
| InChIKey | OUPYQWYNKRKLMR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |