C25H25N7O3 — CID 138537302
1-[2-(oxetan-3-yloxy)-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138537302) has the molecular formula C25H25N7O3 and a molecular weight of 471.52 g/mol. Its IUPAC name is 1-[2-(oxetan-3-yloxy)-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[2-(oxetan-3-yloxy)-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138537302 |
| Molecular Formula | C25H25N7O3 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-[2-(oxetan-3-yloxy)-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)CNCC4)nc2n1-c1ccnc(OC2COC2)c1 |
| InChI | InChI=1S/C25H25N7O3/c1-2-9-31-24(33)21-13-28-25(29-18-4-3-16-5-7-26-12-17(16)10-18)30-23(21)32(31)19-6-8-27-22(11-19)35-20-14-34-15-20/h2-4,6,8,10-11,13,20,26H,1,5,7,9,12,14-15H2,(H,28,29,30) |
| InChIKey | HYVNNZMDAHPNRO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|