C25H28N8O — CID 138537495
1-(2-tert-butyl-4-pyridinyl)-2-prop-2-enyl-6-(5,6,7,8-tetrahydro-1,7-naphthyridin-3-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138537495) has the molecular formula C25H28N8O and a molecular weight of 456.55 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-pyridinyl)-2-prop-2-enyl-6-(5,6,7,8-tetrahydro-1,7-naphthyridin-3-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(2-tert-butyl-4-pyridinyl)-2-prop-2-enyl-6-(5,6,7,8-tetrahydro-1,7-naphthyridin-3-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138537495 |
| Molecular Formula | C25H28N8O |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-(2-tert-butyl-4-pyridinyl)-2-prop-2-enyl-6-(5,6,7,8-tetrahydro-1,7-naphthyridin-3-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3cnc4c(c3)CCNC4)nc2n1-c1ccnc(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H28N8O/c1-5-10-32-23(34)19-14-29-24(30-17-11-16-6-8-26-15-20(16)28-13-17)31-22(19)33(32)18-7-9-27-21(12-18)25(2,3)4/h5,7,9,11-14,26H,1,6,8,10,15H2,2-4H3,(H,29,30,31) |
| InChIKey | WQPRMLQTMXHQLG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 102.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|