C29H35N7O — CID 138538089
1-[3-tert-butyl-4-(dimethylamino)phenyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138538089) has the molecular formula C29H35N7O and a molecular weight of 497.65 g/mol. Its IUPAC name is 1-[3-tert-butyl-4-(dimethylamino)phenyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[3-tert-butyl-4-(dimethylamino)phenyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138538089 |
| Molecular Formula | C29H35N7O |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 1-[3-tert-butyl-4-(dimethylamino)phenyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)CCNC4)nc2n1-c1ccc(N(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H35N7O/c1-7-14-35-27(37)23-18-31-28(32-21-9-8-20-17-30-13-12-19(20)15-21)33-26(23)36(35)22-10-11-25(34(5)6)24(16-22)29(2,3)4/h7-11,15-16,18,30H,1,12-14,17H2,2-6H3,(H,31,32,33) |
| InChIKey | ICEGKJJTPNUPGJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|