C28H34N8O — CID 138536790
1-[2-[[ethyl(propan-2-yl)amino]methyl]-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138536790) has the molecular formula C28H34N8O and a molecular weight of 498.64 g/mol. Its IUPAC name is 1-[2-[[ethyl(propan-2-yl)amino]methyl]-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[2-[[ethyl(propan-2-yl)amino]methyl]-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138536790 |
| Molecular Formula | C28H34N8O |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | 1-[2-[[ethyl(propan-2-yl)amino]methyl]-4-pyridinyl]-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)CCNC4)nc2n1-c1ccnc(CN(CC)C(C)C)c1 |
| InChI | InChI=1S/C28H34N8O/c1-5-13-35-27(37)25-17-31-28(32-22-8-7-21-16-29-11-9-20(21)14-22)33-26(25)36(35)24-10-12-30-23(15-24)18-34(6-2)19(3)4/h5,7-8,10,12,14-15,17,19,29H,1,6,9,11,13,16,18H2,2-4H3,(H,31,32,33) |
| InChIKey | NYISRFPRHNJHKS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|