C24H27N7OS — CID 138537664
1-(2-tert-butyl-1,3-thiazol-4-yl)-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138537664) has the molecular formula C24H27N7OS and a molecular weight of 461.60 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-thiazol-4-yl)-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(2-tert-butyl-1,3-thiazol-4-yl)-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138537664 |
| Molecular Formula | C24H27N7OS |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 1-(2-tert-butyl-1,3-thiazol-4-yl)-2-prop-2-enyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)CNCC4)nc2n1-c1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C24H27N7OS/c1-5-10-30-21(32)18-13-26-23(27-17-7-6-15-8-9-25-12-16(15)11-17)29-20(18)31(30)19-14-33-22(28-19)24(2,3)4/h5-7,11,13-14,25H,1,8-10,12H2,2-4H3,(H,26,27,29) |
| InChIKey | IGTZZLOFRSEBHB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|