C23H27N7OS — CID 138536973
1-(2-tert-butyl-1,3-thiazol-4-yl)-2-ethyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138536973) has the molecular formula C23H27N7OS and a molecular weight of 449.58 g/mol. Its IUPAC name is 1-(2-tert-butyl-1,3-thiazol-4-yl)-2-ethyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(2-tert-butyl-1,3-thiazol-4-yl)-2-ethyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138536973 |
| Molecular Formula | C23H27N7OS |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-(2-tert-butyl-1,3-thiazol-4-yl)-2-ethyl-6-(1,2,3,4-tetrahydroisoquinolin-7-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | CCn1c(=O)c2cnc(Nc3ccc4c(c3)CNCC4)nc2n1-c1csc(C(C)(C)C)n1 |
| InChI | InChI=1S/C23H27N7OS/c1-5-29-20(31)17-12-25-22(26-16-7-6-14-8-9-24-11-15(14)10-16)28-19(17)30(29)18-13-32-21(27-18)23(2,3)4/h6-7,10,12-13,24H,5,8-9,11H2,1-4H3,(H,25,26,28) |
| InChIKey | JFLDSDODWOJQJE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |