C29H35N7O — CID 138537817
1-(2-tert-butyl-4-pyridinyl)-6-[[7-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 138537817) has the molecular formula C29H35N7O and a molecular weight of 497.65 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-pyridinyl)-6-[[7-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(2-tert-butyl-4-pyridinyl)-6-[[7-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 138537817 |
| Molecular Formula | C29H35N7O |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 1-(2-tert-butyl-4-pyridinyl)-6-[[7-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)CC(N(C)C)CC4)nc2n1-c1ccnc(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H35N7O/c1-7-14-35-27(37)24-18-31-28(32-21-10-8-19-9-11-22(34(5)6)16-20(19)15-21)33-26(24)36(35)23-12-13-30-25(17-23)29(2,3)4/h7-8,10,12-13,15,17-18,22H,1,9,11,14,16H2,2-6H3,(H,31,32,33) |
| InChIKey | APTKNXPIXJQVJD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|