C27H31ClN8O2S — CID 167229771
1-[3-chloro-6-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-pyridinyl]-6-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 167229771) has the molecular formula C27H31ClN8O2S and a molecular weight of 567.12 g/mol. Its IUPAC name is 1-[3-chloro-6-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-pyridinyl]-6-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[3-chloro-6-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-pyridinyl]-6-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 167229771 |
| Molecular Formula | C27H31ClN8O2S |
| Molecular Weight | 567.12 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | 1-[3-chloro-6-[[dimethyl(oxo)-λ6-sulfanylidene]amino]-2-pyridinyl]-6-[[6-(dimethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc4c(c3)CCC(N(C)C)C4)nc2n1-c1nc(N=S(C)(C)=O)ccc1Cl |
| InChI | InChI=1S/C27H31ClN8O2S/c1-6-13-35-26(37)21-16-29-27(30-19-9-7-18-15-20(34(2)3)10-8-17(18)14-19)32-24(21)36(35)25-22(28)11-12-23(31-25)33-39(4,5)38/h6-7,9,11-12,14,16,20H,1,8,10,13,15H2,2-5H3,(H,29,30,32) |
| InChIKey | HFTUBISEBGQYJV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.12 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|